C16H25NO2S — CID 115567312
N-octyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 115567312) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-octyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-octyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 115567312 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-octyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCCCCCCCNC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H25NO2S/c1-2-3-4-5-6-9-12-17-15-13-20(18,19)16-11-8-7-10-14(15)16/h7-8,10-11,15,17H,2-6,9,12-13H2,1H3 |
| InChIKey | STWATMFGLHZASV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|