C14H21NO2S — CID 55033645
N-hexan-3-yl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 55033645) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-hexan-3-yl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-hexan-3-yl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 55033645 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-hexan-3-yl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCCC(CC)NC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H21NO2S/c1-3-7-11(4-2)15-13-10-18(16,17)14-9-6-5-8-12(13)14/h5-6,8-9,11,13,15H,3-4,7,10H2,1-2H3 |
| InChIKey | BPWKEANLLRVURO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |