C15H21NO4S — CID 95771982
(2S)-2-butoxy-N-[(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl]propanamide (PubChem CID 95771982) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is (2S)-2-butoxy-N-[(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl]propanamide.
| Compound Name | (2S)-2-butoxy-N-[(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl]propanamide |
|---|---|
| PubChem CID | 95771982 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S)-2-butoxy-N-[(3S)-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl]propanamide |
| SMILES | CCCCO[C@@H](C)C(=O)N[C@@H]1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H21NO4S/c1-3-4-9-20-11(2)15(17)16-13-10-21(18,19)14-8-6-5-7-12(13)14/h5-8,11,13H,3-4,9-10H2,1-2H3,(H,16,17)/t11-,13+/m0/s1 |
| InChIKey | IGDLKGDZHCOBMM-WCQYABFASA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|