C14H18N2 — CID 103982195
N-but-3-ynyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103982195) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-but-3-ynyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-but-3-ynyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103982195 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-but-3-ynyl-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | C#CCCNC1CCNCc2ccccc21 |
| InChI | InChI=1S/C14H18N2/c1-2-3-9-16-14-8-10-15-11-12-6-4-5-7-13(12)14/h1,4-7,14-16H,3,8-11H2 |
| InChIKey | ANZOCTKUNORJLN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|