C12H18N2O — CID 103982717
N-ethoxy-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103982717) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-ethoxy-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-ethoxy-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103982717 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-ethoxy-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | CCONC1CCNCc2ccccc21 |
| InChI | InChI=1S/C12H18N2O/c1-2-15-14-12-7-8-13-9-10-5-3-4-6-11(10)12/h3-6,12-14H,2,7-9H2,1H3 |
| InChIKey | YFEZBGZMEPEGIC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|