C11H11N — CID 130651955
N-prop-2-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-amine (PubChem CID 130651955) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is N-prop-2-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-amine.
| Compound Name | N-prop-2-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-amine |
|---|---|
| PubChem CID | 130651955 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-prop-2-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-amine |
| SMILES | C#CCNC1Cc2ccccc21 |
| InChI | InChI=1S/C11H11N/c1-2-7-12-11-8-9-5-3-4-6-10(9)11/h1,3-6,11-12H,7-8H2 |
| InChIKey | ULABELZWLPMJKF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|