C18H21NO2 — CID 107683685
3-[[1-(ethylamino)-2,3-dihydro-1H-inden-5-yl]oxymethyl]phenol (PubChem CID 107683685) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[[1-(ethylamino)-2,3-dihydro-1H-inden-5-yl]oxymethyl]phenol.
| Compound Name | 3-[[1-(ethylamino)-2,3-dihydro-1H-inden-5-yl]oxymethyl]phenol |
|---|---|
| PubChem CID | 107683685 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-[[1-(ethylamino)-2,3-dihydro-1H-inden-5-yl]oxymethyl]phenol |
| SMILES | CCNC1CCc2cc(OCc3cccc(O)c3)ccc21 |
| InChI | InChI=1S/C18H21NO2/c1-2-19-18-9-6-14-11-16(7-8-17(14)18)21-12-13-4-3-5-15(20)10-13/h3-5,7-8,10-11,18-20H,2,6,9,12H2,1H3 |
| InChIKey | HUQRJDONJIPFJF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |