C16H23NO — CID 76919283
6-but-2-enoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 76919283) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-but-2-enoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 6-but-2-enoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 76919283 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 6-but-2-enoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC=CCOc1ccc2c(c1)CCCC2NCC |
| InChI | InChI=1S/C16H23NO/c1-3-5-11-18-14-9-10-15-13(12-14)7-6-8-16(15)17-4-2/h3,5,9-10,12,16-17H,4,6-8,11H2,1-2H3 |
| InChIKey | OTXDEDOURYQVGU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|