C18H25NO2 — CID 21287296
6-(1,3-dimethylazepan-4-yl)oxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 21287296) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 6-(1,3-dimethylazepan-4-yl)oxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-(1,3-dimethylazepan-4-yl)oxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 21287296 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 6-(1,3-dimethylazepan-4-yl)oxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1CN(C)CCCC1Oc1ccc2c(c1)CCCC2=O |
| InChI | InChI=1S/C18H25NO2/c1-13-12-19(2)10-4-7-18(13)21-15-8-9-16-14(11-15)5-3-6-17(16)20/h8-9,11,13,18H,3-7,10,12H2,1-2H3 |
| InChIKey | PJJFYQJJQKPEJA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |