C16H25NOS — CID 23339165
4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane (PubChem CID 23339165) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane.
| Compound Name | 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane |
|---|---|
| PubChem CID | 23339165 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane |
| SMILES | CCSc1ccc(OC2CCCN(C)CC2C)cc1 |
| InChI | InChI=1S/C16H25NOS/c1-4-19-15-9-7-14(8-10-15)18-16-6-5-11-17(3)12-13(16)2/h7-10,13,16H,4-6,11-12H2,1-3H3 |
| InChIKey | AJEVLSXSVDLTJQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |