About 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane
4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane (PubChem CID 23339165) has the molecular formula C16H25NOS
and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane.
Molecular Properties
| Compound Name | 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane |
| PubChem CID | 23339165 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane |
| SMILES | CCSc1ccc(OC2CCCN(C)CC2C)cc1 |
| InChI | InChI=1S/C16H25NOS/c1-4-19-15-9-7-14(8-10-15)18-16-6-5-11-17(3)12-13(16)2/h7-10,13,16H,4-6,11-12H2,1-3H3 |
| InChIKey | AJEVLSXSVDLTJQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane?
The IUPAC name of 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane (CID 23339165) is 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane.
What is the SMILES notation for 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane?
The canonical SMILES for 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane is CCSc1ccc(OC2CCCN(C)CC2C)cc1.
What is the InChIKey of 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane?
The InChIKey is AJEVLSXSVDLTJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NOS/c1-4-19-15-9-7-14(8-10-15)18-16-6-5-11-17(3)12-13(16)2/h7-10,13,16H,4-6,11-12H2,1-3H3.
What are the key properties of 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane?
4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane has a molecular weight of 279.45 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylsulfanylphenoxy)-1,3-dimethylazepane is sourced from PubChem (CID 23339165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).