About 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one
3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one (PubChem CID 21287268) has the molecular formula C21H29NO3
and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one.
Molecular Properties
| Compound Name | 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one |
| PubChem CID | 21287268 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one |
| SMILES | CC1CN(C)CCCC1Oc1ccc2occ(C(C)(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C21H29NO3/c1-14-12-22(5)10-6-7-18(14)25-15-8-9-19-16(11-15)20(23)17(13-24-19)21(2,3)4/h8-9,11,13-14,18H,6-7,10,12H2,1-5H3 |
| InChIKey | GSMXOFTYTJYXCD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one?
The IUPAC name of 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one (CID 21287268) is 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one.
What is the SMILES notation for 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one?
The canonical SMILES for 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one is CC1CN(C)CCCC1Oc1ccc2occ(C(C)(C)C)c(=O)c2c1.
What is the InChIKey of 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one?
The InChIKey is GSMXOFTYTJYXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO3/c1-14-12-22(5)10-6-7-18(14)25-15-8-9-19-16(11-15)20(23)17(13-24-19)21(2,3)4/h8-9,11,13-14,18H,6-7,10,12H2,1-5H3.
What are the key properties of 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one?
3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one has a molecular weight of 343.47 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6-(1,3-dimethylazepan-4-yl)oxychromen-4-one is sourced from PubChem (CID 21287268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).