C26H31NO3 — CID 21287457
3-tert-butyl-7-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one (PubChem CID 21287457) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-tert-butyl-7-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one.
| Compound Name | 3-tert-butyl-7-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one |
|---|---|
| PubChem CID | 21287457 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-tert-butyl-7-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one |
| SMILES | CN1CCCC(C(Oc2ccc3cc(C(C)(C)C)c(=O)oc3c2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H31NO3/c1-26(2,3)22-15-19-12-13-21(16-23(19)30-25(22)28)29-24(18-9-6-5-7-10-18)20-11-8-14-27(4)17-20/h5-7,9-10,12-13,15-16,20,24H,8,11,14,17H2,1-4H3 |
| InChIKey | PPFFZBXNDQPCJI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|