C28H33NO3 — CID 88650357
3-cyclohexyl-6-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one (PubChem CID 88650357) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-cyclohexyl-6-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one.
| Compound Name | 3-cyclohexyl-6-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one |
|---|---|
| PubChem CID | 88650357 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-cyclohexyl-6-[(1-methylpiperidin-3-yl)-phenylmethoxy]chromen-2-one |
| SMILES | CN1CCCC(C(Oc2ccc3oc(=O)c(C4CCCCC4)cc3c2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H33NO3/c1-29-16-8-13-22(19-29)27(21-11-6-3-7-12-21)31-24-14-15-26-23(17-24)18-25(28(30)32-26)20-9-4-2-5-10-20/h3,6-7,11-12,14-15,17-18,20,22,27H,2,4-5,8-10,13,16,19H2,1H3 |
| InChIKey | XFIRPRRNIUUSMD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|