C25H26O4 — CID 68514252
4-[cyclohexyl-(2-methyl-5-phenylfuran-3-yl)methoxy]benzoic acid (PubChem CID 68514252) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[cyclohexyl-(2-methyl-5-phenylfuran-3-yl)methoxy]benzoic acid.
| Compound Name | 4-[cyclohexyl-(2-methyl-5-phenylfuran-3-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 68514252 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[cyclohexyl-(2-methyl-5-phenylfuran-3-yl)methoxy]benzoic acid |
| SMILES | Cc1oc(-c2ccccc2)cc1C(Oc1ccc(C(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H26O4/c1-17-22(16-23(28-17)18-8-4-2-5-9-18)24(19-10-6-3-7-11-19)29-21-14-12-20(13-15-21)25(26)27/h2,4-5,8-9,12-16,19,24H,3,6-7,10-11H2,1H3,(H,26,27) |
| InChIKey | WHRKSIHUAULFOM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |