C30H34F3NO5 — CID 143799622
4-[cyclohexyl-[3-methyl-5-[4-(trifluoromethyl)phenyl]furan-2-yl]methoxy]-N-propylbenzamide;formic acid (PubChem CID 143799622) has the molecular formula C30H34F3NO5 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[cyclohexyl-[3-methyl-5-[4-(trifluoromethyl)phenyl]furan-2-yl]methoxy]-N-propylbenzamide;formic acid.
| Compound Name | 4-[cyclohexyl-[3-methyl-5-[4-(trifluoromethyl)phenyl]furan-2-yl]methoxy]-N-propylbenzamide;formic acid |
|---|---|
| PubChem CID | 143799622 |
| Molecular Formula | C30H34F3NO5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 4-[cyclohexyl-[3-methyl-5-[4-(trifluoromethyl)phenyl]furan-2-yl]methoxy]-N-propylbenzamide;formic acid |
| SMILES | CCCNC(=O)c1ccc(OC(c2oc(-c3ccc(C(F)(F)F)cc3)cc2C)C2CCCCC2)cc1.O=CO |
| InChI | InChI=1S/C29H32F3NO3.CH2O2/c1-3-17-33-28(34)22-11-15-24(16-12-22)35-27(21-7-5-4-6-8-21)26-19(2)18-25(36-26)20-9-13-23(14-10-20)29(30,31)32;2-1-3/h9-16,18,21,27H,3-8,17H2,1-2H3,(H,33,34);1H,(H,2,3) |
| InChIKey | IWFJYWPHLLLMSE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|