C27H27F3O4 — CID 68511535
4-[cyclohexyl-[2-ethyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]methoxy]benzoic acid (PubChem CID 68511535) has the molecular formula C27H27F3O4 and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-[cyclohexyl-[2-ethyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]methoxy]benzoic acid.
| Compound Name | 4-[cyclohexyl-[2-ethyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 68511535 |
| Molecular Formula | C27H27F3O4 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-[cyclohexyl-[2-ethyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]methoxy]benzoic acid |
| SMILES | CCc1oc(-c2ccc(C(F)(F)F)cc2)cc1C(Oc1ccc(C(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H27F3O4/c1-2-23-22(16-24(34-23)17-8-12-20(13-9-17)27(28,29)30)25(18-6-4-3-5-7-18)33-21-14-10-19(11-15-21)26(31)32/h8-16,18,25H,2-7H2,1H3,(H,31,32) |
| InChIKey | DIMXAFASTUCJAX-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |