C29H29F3O3 — CID 67342305
methyl 4-[(1R)-2-cyclohexyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethoxy]benzoate (PubChem CID 67342305) has the molecular formula C29H29F3O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl 4-[(1R)-2-cyclohexyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethoxy]benzoate.
| Compound Name | methyl 4-[(1R)-2-cyclohexyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethoxy]benzoate |
|---|---|
| PubChem CID | 67342305 |
| Molecular Formula | C29H29F3O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | methyl 4-[(1R)-2-cyclohexyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(O[C@H](CC2CCCCC2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H29F3O3/c1-34-28(33)24-13-17-26(18-14-24)35-27(19-20-5-3-2-4-6-20)23-9-7-21(8-10-23)22-11-15-25(16-12-22)29(30,31)32/h7-18,20,27H,2-6,19H2,1H3/t27-/m1/s1 |
| InChIKey | HIMAQRJNDNQBHX-HHHXNRCGSA-N |
| XLogP | 8.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |