About 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide
4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide (PubChem CID 141128357) has the molecular formula C27H28F3NO2
and a molecular weight of 455.52 g/mol. Its IUPAC name is 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide.
Molecular Properties
| Compound Name | 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide |
| PubChem CID | 141128357 |
| Molecular Formula | C27H28F3NO2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide |
| SMILES | CC(C)(C)CCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C27H28F3NO2/c1-26(2,3)17-16-24(20-4-6-21(7-5-20)25(31)32)33-23-14-10-19(11-15-23)18-8-12-22(13-9-18)27(28,29)30/h4-15,24H,16-17H2,1-3H3,(H2,31,32) |
| InChIKey | IXUFUXRFGKYCAU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide?
The IUPAC name of 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide (CID 141128357) is 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide.
What is the SMILES notation for 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide?
The canonical SMILES for 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide is CC(C)(C)CCC(Oc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(C(N)=O)cc1.
What is the InChIKey of 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide?
The InChIKey is IXUFUXRFGKYCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28F3NO2/c1-26(2,3)17-16-24(20-4-6-21(7-5-20)25(31)32)33-23-14-10-19(11-15-23)18-8-12-22(13-9-18)27(28,29)30/h4-15,24H,16-17H2,1-3H3,(H2,31,32).
What are the key properties of 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide?
4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide has a molecular weight of 455.52 g/mol, XLogP of 7.42, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,4-dimethyl-1-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzamide is sourced from PubChem (CID 141128357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).