C24H27F3O3 — CID 70260779
methyl 2-[3-butoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoate (PubChem CID 70260779) has the molecular formula C24H27F3O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 2-[3-butoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoate.
| Compound Name | methyl 2-[3-butoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 70260779 |
| Molecular Formula | C24H27F3O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | methyl 2-[3-butoxy-5-[4-(trifluoromethyl)phenyl]phenyl]-3-cyclopropylpropanoate |
| SMILES | CCCCOc1cc(-c2ccc(C(F)(F)F)cc2)cc(C(CC2CC2)C(=O)OC)c1 |
| InChI | InChI=1S/C24H27F3O3/c1-3-4-11-30-21-14-18(17-7-9-20(10-8-17)24(25,26)27)13-19(15-21)22(23(28)29-2)12-16-5-6-16/h7-10,13-16,22H,3-6,11-12H2,1-2H3 |
| InChIKey | QFWPQXPIBLYARK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|