C23H23F4IO3 — CID 88589735
ethyl 3-cyclopropyl-2-[3-(2-fluoroethoxy)-5-iodo-4-[4-(trifluoromethyl)phenyl]phenyl]propanoate (PubChem CID 88589735) has the molecular formula C23H23F4IO3 and a molecular weight of 550.33 g/mol. Its IUPAC name is ethyl 3-cyclopropyl-2-[3-(2-fluoroethoxy)-5-iodo-4-[4-(trifluoromethyl)phenyl]phenyl]propanoate.
| Compound Name | ethyl 3-cyclopropyl-2-[3-(2-fluoroethoxy)-5-iodo-4-[4-(trifluoromethyl)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 88589735 |
| Molecular Formula | C23H23F4IO3 |
| Molecular Weight | 550.33 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | ethyl 3-cyclopropyl-2-[3-(2-fluoroethoxy)-5-iodo-4-[4-(trifluoromethyl)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)C(CC1CC1)c1cc(I)c(-c2ccc(C(F)(F)F)cc2)c(OCCF)c1 |
| InChI | InChI=1S/C23H23F4IO3/c1-2-30-22(29)18(11-14-3-4-14)16-12-19(28)21(20(13-16)31-10-9-24)15-5-7-17(8-6-15)23(25,26)27/h5-8,12-14,18H,2-4,9-11H2,1H3 |
| InChIKey | JSZTVOWBXBQNDF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.33 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|