C15H19NO3 — CID 103141087
7-[(5-methyloxolan-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 103141087) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 7-[(5-methyloxolan-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[(5-methyloxolan-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 103141087 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 7-[(5-methyloxolan-2-yl)methoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC1CCC(COc2ccc3c(c2)NC(=O)CC3)O1 |
| InChI | InChI=1S/C15H19NO3/c1-10-2-5-13(19-10)9-18-12-6-3-11-4-7-15(17)16-14(11)8-12/h3,6,8,10,13H,2,4-5,7,9H2,1H3,(H,16,17) |
| InChIKey | UXDDPYZVZWUEMD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |