C17H23NO2 — CID 114940266
7-(4-ethylcyclohexyl)oxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114940266) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 7-(4-ethylcyclohexyl)oxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(4-ethylcyclohexyl)oxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114940266 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 7-(4-ethylcyclohexyl)oxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCC1CCC(Oc2ccc3c(c2)NC(=O)CC3)CC1 |
| InChI | InChI=1S/C17H23NO2/c1-2-12-3-7-14(8-4-12)20-15-9-5-13-6-10-17(19)18-16(13)11-15/h5,9,11-12,14H,2-4,6-8,10H2,1H3,(H,18,19) |
| InChIKey | MXEOZDJCQABOPB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |