About 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride
6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 82021825) has the molecular formula C13H17ClN2O2
and a molecular weight of 268.74 g/mol. Its IUPAC name is 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride |
| PubChem CID | 82021825 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | Cl.O=C1Cc2ccc(OC3CCNCC3)cc2N1 |
| InChI | InChI=1S/C13H16N2O2.ClH/c16-13-7-9-1-2-11(8-12(9)15-13)17-10-3-5-14-6-4-10;/h1-2,8,10,14H,3-7H2,(H,15,16);1H |
| InChIKey | GCCBSSGOELXITP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride?
The IUPAC name of 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride (CID 82021825) is 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride.
What is the SMILES notation for 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride?
The canonical SMILES for 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride is Cl.O=C1Cc2ccc(OC3CCNCC3)cc2N1.
What is the InChIKey of 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride?
The InChIKey is GCCBSSGOELXITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2.ClH/c16-13-7-9-1-2-11(8-12(9)15-13)17-10-3-5-14-6-4-10;/h1-2,8,10,14H,3-7H2,(H,15,16);1H.
What are the key properties of 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride?
6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride has a molecular weight of 268.74 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-yloxy-1,3-dihydroindol-2-one;hydrochloride is sourced from PubChem (CID 82021825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).