C14H19ClFNO2 — CID 168639707
1-chloro-3-(2-cyclopentyloxy-6-fluoroanilino)propan-2-ol (PubChem CID 168639707) has the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. Its IUPAC name is 1-chloro-3-(2-cyclopentyloxy-6-fluoroanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(2-cyclopentyloxy-6-fluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 168639707 |
| Molecular Formula | C14H19ClFNO2 |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-chloro-3-(2-cyclopentyloxy-6-fluoroanilino)propan-2-ol |
| SMILES | OC(CCl)CNc1c(F)cccc1OC1CCCC1 |
| InChI | InChI=1S/C14H19ClFNO2/c15-8-10(18)9-17-14-12(16)6-3-7-13(14)19-11-4-1-2-5-11/h3,6-7,10-11,17-18H,1-2,4-5,8-9H2 |
| InChIKey | MPFUOPANCHXQHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|