C20H22N6O3 — CID 122308248
benzyl N-[2-oxo-2-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylamino]ethyl]carbamate (PubChem CID 122308248) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylamino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 122308248 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | benzyl N-[2-oxo-2-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylamino]ethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCCNc1cc(-n2cccc2)ncn1 |
| InChI | InChI=1S/C20H22N6O3/c27-19(13-23-20(28)29-14-16-6-2-1-3-7-16)22-9-8-21-17-12-18(25-15-24-17)26-10-4-5-11-26/h1-7,10-12,15H,8-9,13-14H2,(H,22,27)(H,23,28)(H,21,24,25) |
| InChIKey | HDOFLRCFIDQHJN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|