C18H17ClFN5O — CID 122308294
2-(2-chloro-6-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 122308294) has the molecular formula C18H17ClFN5O and a molecular weight of 373.82 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122308294 |
| Molecular Formula | C18H17ClFN5O |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NCCNc1cc(-n2cccc2)ncn1 |
| InChI | InChI=1S/C18H17ClFN5O/c19-14-4-3-5-15(20)13(14)10-18(26)22-7-6-21-16-11-17(24-12-23-16)25-8-1-2-9-25/h1-5,8-9,11-12H,6-7,10H2,(H,22,26)(H,21,23,24) |
| InChIKey | HPNNMTTTWJTBCV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|