C21H19N5O — CID 122308040
N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]naphthalene-2-carboxamide (PubChem CID 122308040) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 122308040 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCNc1cc(-n2cccc2)ncn1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19N5O/c27-21(18-8-7-16-5-1-2-6-17(16)13-18)23-10-9-22-19-14-20(25-15-24-19)26-11-3-4-12-26/h1-8,11-15H,9-10H2,(H,23,27)(H,22,24,25) |
| InChIKey | QMHCWKDXEJWDJR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|