C16H19N7OS — CID 122308142
4-propyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]thiadiazole-5-carboxamide (PubChem CID 122308142) has the molecular formula C16H19N7OS and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-propyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-propyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 122308142 |
| Molecular Formula | C16H19N7OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-propyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]thiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCCNc1cc(-n2cccc2)ncn1 |
| InChI | InChI=1S/C16H19N7OS/c1-2-5-12-15(25-22-21-12)16(24)18-7-6-17-13-10-14(20-11-19-13)23-8-3-4-9-23/h3-4,8-11H,2,5-7H2,1H3,(H,18,24)(H,17,19,20) |
| InChIKey | RRHHZISPRZXNHU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|