C19H21N5O — CID 122308024
3,4-dimethyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]benzamide (PubChem CID 122308024) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122308024 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3,4-dimethyl-N-[2-[(6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2cc(-n3cccc3)ncn2)cc1C |
| InChI | InChI=1S/C19H21N5O/c1-14-5-6-16(11-15(14)2)19(25)21-8-7-20-17-12-18(23-13-22-17)24-9-3-4-10-24/h3-6,9-13H,7-8H2,1-2H3,(H,21,25)(H,20,22,23) |
| InChIKey | KSHLASFAULNVGJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|