C18H20ClFN4O — CID 90546137
2-(2-chloro-6-fluorophenyl)-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]acetamide (PubChem CID 90546137) has the molecular formula C18H20ClFN4O and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 90546137 |
| Molecular Formula | C18H20ClFN4O |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]acetamide |
| SMILES | CC1CCN(c2cc(NC(=O)Cc3c(F)cccc3Cl)ncn2)CC1 |
| InChI | InChI=1S/C18H20ClFN4O/c1-12-5-7-24(8-6-12)17-10-16(21-11-22-17)23-18(25)9-13-14(19)3-2-4-15(13)20/h2-4,10-12H,5-9H2,1H3,(H,21,22,23,25) |
| InChIKey | GFLOGGQXWNYDPU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |