C20H26N6O3 — CID 122350841
benzyl N-[2-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 122350841) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is benzyl N-[2-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 122350841 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | benzyl N-[2-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CCNc1ccc(N2CCN(C(=O)CNC(=O)OCc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C20H26N6O3/c1-2-21-17-8-9-18(24-23-17)25-10-12-26(13-11-25)19(27)14-22-20(28)29-15-16-6-4-3-5-7-16/h3-9H,2,10-15H2,1H3,(H,21,23)(H,22,28) |
| InChIKey | ACKSIGSFXNLSRM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |