C19H25N5O — CID 122350608
[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-(4-ethylphenyl)methanone (PubChem CID 122350608) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-(4-ethylphenyl)methanone.
| Compound Name | [4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 122350608 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | [4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]-(4-ethylphenyl)methanone |
| SMILES | CCNc1ccc(N2CCN(C(=O)c3ccc(CC)cc3)CC2)nn1 |
| InChI | InChI=1S/C19H25N5O/c1-3-15-5-7-16(8-6-15)19(25)24-13-11-23(12-14-24)18-10-9-17(20-4-2)21-22-18/h5-10H,3-4,11-14H2,1-2H3,(H,20,21) |
| InChIKey | WICWPXXSPOUJDD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |