C21H23ClN6O — CID 122326910
3-(3-chlorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide (PubChem CID 122326910) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122326910 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]propanamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)CCc3cccc(Cl)c3)nn2)nc1 |
| InChI | InChI=1S/C21H23ClN6O/c1-15-5-7-18(25-14-15)26-20-9-8-19(27-28-20)23-11-12-24-21(29)10-6-16-3-2-4-17(22)13-16/h2-5,7-9,13-14H,6,10-12H2,1H3,(H,23,27)(H,24,29)(H,25,26,28) |
| InChIKey | FSUBEZJNJWZUPV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|