C17H16Cl2N6O2 — CID 122292661
2-(2,4-dichlorophenoxy)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide (PubChem CID 122292661) has the molecular formula C17H16Cl2N6O2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122292661 |
| Molecular Formula | C17H16Cl2N6O2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCNc1ccc(-n2cccn2)nn1 |
| InChI | InChI=1S/C17H16Cl2N6O2/c18-12-2-3-14(13(19)10-12)27-11-17(26)21-8-7-20-15-4-5-16(24-23-15)25-9-1-6-22-25/h1-6,9-10H,7-8,11H2,(H,20,23)(H,21,26) |
| InChIKey | OIOJGSJKCDJDMG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|