C17H21Cl2N5O2 — CID 122325285
2-(2,4-dichlorophenoxy)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122325285) has the molecular formula C17H21Cl2N5O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122325285 |
| Molecular Formula | C17H21Cl2N5O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CCNc1nc(C)cc(NCCNC(=O)COc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H21Cl2N5O2/c1-3-20-17-23-11(2)8-15(24-17)21-6-7-22-16(25)10-26-14-5-4-12(18)9-13(14)19/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,22,25)(H2,20,21,23,24) |
| InChIKey | YMQJOKBJUHEWNW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|