C15H15ClN6O2S — CID 16654544
2-chloro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 16654544) has the molecular formula C15H15ClN6O2S and a molecular weight of 378.85 g/mol. Its IUPAC name is 2-chloro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16654544 |
| Molecular Formula | C15H15ClN6O2S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-chloro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(-n2cccn2)nn1)c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN6O2S/c16-12-4-1-2-5-13(12)25(23,24)19-10-9-17-14-6-7-15(21-20-14)22-11-3-8-18-22/h1-8,11,19H,9-10H2,(H,17,20) |
| InChIKey | WCGHHIYYHKCQFD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|