C23H22N6O3S — CID 122314206
4-phenoxy-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122314206) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is 4-phenoxy-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-phenoxy-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122314206 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-phenoxy-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(Nc2ccccn2)ncn1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N6O3S/c30-33(31,20-11-9-19(10-12-20)32-18-6-2-1-3-7-18)28-15-14-25-22-16-23(27-17-26-22)29-21-8-4-5-13-24-21/h1-13,16-17,28H,14-15H2,(H2,24,25,26,27,29) |
| InChIKey | JUWUFSYOJHUYDT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|