C20H24N6O2S — CID 122315030
4-ethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122315030) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-ethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122315030 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-ethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCNc2cc(Nc3ccccn3)nc(C)n2)cc1 |
| InChI | InChI=1S/C20H24N6O2S/c1-3-16-7-9-17(10-8-16)29(27,28)23-13-12-22-19-14-20(25-15(2)24-19)26-18-6-4-5-11-21-18/h4-11,14,23H,3,12-13H2,1-2H3,(H2,21,22,24,25,26) |
| InChIKey | AKFJDVXFNFUFHM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|