C17H22N8O2S — CID 122315280
1,2-dimethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122315280) has the molecular formula C17H22N8O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1,2-dimethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1,2-dimethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122315280 |
| Molecular Formula | C17H22N8O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1,2-dimethyl-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]imidazole-4-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cn(C)c(C)n2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C17H22N8O2S/c1-12-21-15(10-16(22-12)24-14-6-4-5-7-18-14)19-8-9-20-28(26,27)17-11-25(3)13(2)23-17/h4-7,10-11,20H,8-9H2,1-3H3,(H2,18,19,21,22,24) |
| InChIKey | HZYQNWRUZAXCKE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|