C15H20N6O2 — CID 122314926
2-methoxy-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122314926) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-methoxy-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-methoxy-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122314926 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-methoxy-N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | COCC(=O)NCCNc1cc(Nc2ccccn2)nc(C)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-11-19-13(17-7-8-18-15(22)10-23-2)9-14(20-11)21-12-5-3-4-6-16-12/h3-6,9H,7-8,10H2,1-2H3,(H,18,22)(H2,16,17,19,20,21) |
| InChIKey | DRXJVIKRKFFMRD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|