C23H22N6OS — CID 122315171
N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-4-thiophen-2-ylbenzamide (PubChem CID 122315171) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 122315171 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[2-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-4-thiophen-2-ylbenzamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccc(-c3cccs3)cc2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C23H22N6OS/c1-16-27-21(15-22(28-16)29-20-6-2-3-11-24-20)25-12-13-26-23(30)18-9-7-17(8-10-18)19-5-4-14-31-19/h2-11,14-15H,12-13H2,1H3,(H,26,30)(H2,24,25,27,28,29) |
| InChIKey | BWIUKPISUPQWAZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|