C26H20N6OS — CID 122316024
N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]-4-thiophen-2-ylbenzamide (PubChem CID 122316024) has the molecular formula C26H20N6OS and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 122316024 |
| Molecular Formula | C26H20N6OS |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]-4-thiophen-2-ylbenzamide |
| SMILES | O=C(Nc1ccc(Nc2cc(Nc3ccccn3)ncn2)cc1)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C26H20N6OS/c33-26(19-8-6-18(7-9-19)22-4-3-15-34-22)31-21-12-10-20(11-13-21)30-24-16-25(29-17-28-24)32-23-5-1-2-14-27-23/h1-17H,(H,31,33)(H2,27,28,29,30,32) |
| InChIKey | QZOOGKXEAOSNDU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |