C23H19FN6O2 — CID 122316013
3-fluoro-4-methoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 122316013) has the molecular formula C23H19FN6O2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122316013 |
| Molecular Formula | C23H19FN6O2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3cc(Nc4ccccn4)ncn3)cc2)cc1F |
| InChI | InChI=1S/C23H19FN6O2/c1-32-19-10-5-15(12-18(19)24)23(31)29-17-8-6-16(7-9-17)28-21-13-22(27-14-26-21)30-20-4-2-3-11-25-20/h2-14H,1H3,(H,29,31)(H2,25,26,27,28,30) |
| InChIKey | RZLPXLVERXFQOB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |