C22H17ClN6O — CID 122315780
2-chloro-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 122315780) has the molecular formula C22H17ClN6O and a molecular weight of 416.87 g/mol. Its IUPAC name is 2-chloro-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122315780 |
| Molecular Formula | C22H17ClN6O |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-chloro-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2cc(Nc3ccccn3)ncn2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN6O/c23-18-6-2-1-5-17(18)22(30)28-16-10-8-15(9-11-16)27-20-13-21(26-14-25-20)29-19-7-3-4-12-24-19/h1-14H,(H,28,30)(H2,24,25,26,27,29) |
| InChIKey | NTEVPLXMXOABPM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |