C19H19N7O4S — CID 122314444
3-methyl-2-oxo-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzoxazole-5-sulfonamide (PubChem CID 122314444) has the molecular formula C19H19N7O4S and a molecular weight of 441.47 g/mol. Its IUPAC name is 3-methyl-2-oxo-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 3-methyl-2-oxo-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 122314444 |
| Molecular Formula | C19H19N7O4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 3-methyl-2-oxo-N-[2-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]ethyl]-1,3-benzoxazole-5-sulfonamide |
| SMILES | Cn1c(=O)oc2ccc(S(=O)(=O)NCCNc3cc(Nc4ccccn4)ncn3)cc21 |
| InChI | InChI=1S/C19H19N7O4S/c1-26-14-10-13(5-6-15(14)30-19(26)27)31(28,29)24-9-8-21-17-11-18(23-12-22-17)25-16-4-2-3-7-20-16/h2-7,10-12,24H,8-9H2,1H3,(H2,20,21,22,23,25) |
| InChIKey | RVSWMQHTENXXFN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|