C18H19N7O4S — CID 122327357
3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxo-1,3-benzoxazole-5-sulfonamide (PubChem CID 122327357) has the molecular formula C18H19N7O4S and a molecular weight of 429.46 g/mol. Its IUPAC name is 3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxo-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxo-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 122327357 |
| Molecular Formula | C18H19N7O4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-2-oxo-1,3-benzoxazole-5-sulfonamide |
| SMILES | Cc1ccn(-c2ccc(NCCNS(=O)(=O)c3ccc4oc(=O)n(C)c4c3)nn2)n1 |
| InChI | InChI=1S/C18H19N7O4S/c1-12-7-10-25(23-12)17-6-5-16(21-22-17)19-8-9-20-30(27,28)13-3-4-15-14(11-13)24(2)18(26)29-15/h3-7,10-11,20H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | GALRYBDFGZOKCP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|