C15H20N8O2S — CID 122327369
1,2-dimethyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122327369) has the molecular formula C15H20N8O2S and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,2-dimethyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1,2-dimethyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122327369 |
| Molecular Formula | C15H20N8O2S |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1,2-dimethyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]imidazole-4-sulfonamide |
| SMILES | Cc1ccn(-c2ccc(NCCNS(=O)(=O)c3cn(C)c(C)n3)nn2)n1 |
| InChI | InChI=1S/C15H20N8O2S/c1-11-6-9-23(21-11)14-5-4-13(19-20-14)16-7-8-17-26(24,25)15-10-22(3)12(2)18-15/h4-6,9-10,17H,7-8H2,1-3H3,(H,16,19) |
| InChIKey | FHPVHAKEDQXQFC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|