C12H14N8 — CID 133449534
6-(3-methylpyrazol-1-yl)-N-[2-(triazol-1-yl)ethyl]pyridazin-3-amine (PubChem CID 133449534) has the molecular formula C12H14N8 and a molecular weight of 270.30 g/mol. Its IUPAC name is 6-(3-methylpyrazol-1-yl)-N-[2-(triazol-1-yl)ethyl]pyridazin-3-amine.
| Compound Name | 6-(3-methylpyrazol-1-yl)-N-[2-(triazol-1-yl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 133449534 |
| Molecular Formula | C12H14N8 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 6-(3-methylpyrazol-1-yl)-N-[2-(triazol-1-yl)ethyl]pyridazin-3-amine |
| SMILES | Cc1ccn(-c2ccc(NCCn3ccnn3)nn2)n1 |
| InChI | InChI=1S/C12H14N8/c1-10-4-7-20(17-10)12-3-2-11(15-16-12)13-5-8-19-9-6-14-18-19/h2-4,6-7,9H,5,8H2,1H3,(H,13,15) |
| InChIKey | JNFGSARESRNYOO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |