C20H22N6O4S — CID 122314630
N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 122314630) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 122314630 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | Cc1ccnc(Nc2cc(NCCNS(=O)(=O)c3ccc4c(c3)OCCO4)ncn2)c1 |
| InChI | InChI=1S/C20H22N6O4S/c1-14-4-5-21-19(10-14)26-20-12-18(23-13-24-20)22-6-7-25-31(27,28)15-2-3-16-17(11-15)30-9-8-29-16/h2-5,10-13,25H,6-9H2,1H3,(H2,21,22,23,24,26) |
| InChIKey | NCJJFPOUDKOANE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|