C19H22N6O2S — CID 121064548
4-methyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121064548) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-methyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121064548 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-methyl-N-[2-[[6-[(4-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNc2ccc(Nc3cc(C)ccn3)nn2)cc1 |
| InChI | InChI=1S/C19H22N6O2S/c1-14-3-5-16(6-4-14)28(26,27)22-12-11-21-17-7-8-18(25-24-17)23-19-13-15(2)9-10-20-19/h3-10,13,22H,11-12H2,1-2H3,(H,21,24)(H,20,23,25) |
| InChIKey | TWUONXKETODUCQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|